Products 858236-77-8
CAS 858236-77-8 is the registry number for 3-(2-Aminoethyl)-3,4-dihydroquinazolin-4-one dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2-aminoethyl)quinazolin-4-one;dihydrochloride (CAS 858236-77-8) is a chemical compound with the molecular formula C10H13Cl2N3O and a molecular weight of 262.13 g/mol. IUPAC name: 3-(2-aminoethyl)quinazolin-4-one;dihydrochloride. InChIKey: BGCMHHRWZOZORM-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3O |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 3-(2-aminoethyl)quinazolin-4-one;dihydrochloride |
| InChIKey | BGCMHHRWZOZORM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)