CAS 1825999-87-8 is the registry number for 4,5-Dichloro-N-((pyrrolidin-2-yl)methyl)-1H-pyrrole-2-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,5-dichloro-N-(pyrrolidin-2-ylmethyl)-1H-pyrrole-2-carboxamide (CAS 1825999-87-8) is a chemical compound with the molecular formula C10H13Cl2N3O and a molecular weight of 262.13 g/mol. IUPAC name: 4,5-dichloro-N-(pyrrolidin-2-ylmethyl)-1H-pyrrole-2-carboxamide. InChIKey: PMWSITGJTCDSPD-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3O |
|---|---|
| Molecular weight | 262.13 g/mol |
| IUPAC name | 4,5-dichloro-N-(pyrrolidin-2-ylmethyl)-1H-pyrrole-2-carboxamide |
| InChIKey | PMWSITGJTCDSPD-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)CNC(=O)C2=CC(=C(N2)Cl)Cl |
Computed by PubChem (NCBI)