Products 1432679-17-8
CAS 1432679-17-8 is the registry number for 6-Chloro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine;hydrochloride (CAS 1432679-17-8) is a chemical compound with the molecular formula C13H16Cl2N2 and a molecular weight of 271.18 g/mol. IUPAC name: 6-chloro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine;hydrochloride. InChIKey: VFWVFJLNVLSSBI-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2 |
|---|---|
| Molecular weight | 271.18 g/mol |
| IUPAC name | 6-chloro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine;hydrochloride |
| InChIKey | VFWVFJLNVLSSBI-UHFFFAOYSA-N |
| SMILES | CNC1CCC2=C(C1)C3=C(N2)C=CC(=C3)Cl.Cl |
Computed by PubChem (NCBI)