CAS 1803566-97-3 is the registry number for (4-Methylphenyl)(pyridin-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-methylphenyl)-pyridin-2-ylmethanamine;dihydrochloride (CAS 1803566-97-3) is a chemical compound with the molecular formula C13H16Cl2N2 and a molecular weight of 271.18 g/mol. IUPAC name: (4-methylphenyl)-pyridin-2-ylmethanamine;dihydrochloride. InChIKey: AXCSICZJMIXDBL-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2 |
|---|---|
| Molecular weight | 271.18 g/mol |
| IUPAC name | (4-methylphenyl)-pyridin-2-ylmethanamine;dihydrochloride |
| InChIKey | AXCSICZJMIXDBL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)