CAS 1432681-28-1 is the registry number for 2-Cyclopropyl-2,3-dihydro-1H-isoindol-4-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-cyclopropyl-1,3-dihydroisoindol-4-amine;dihydrochloride (CAS 1432681-28-1) is a chemical compound with the molecular formula C11H16Cl2N2 and a molecular weight of 247.16 g/mol. IUPAC name: 2-cyclopropyl-1,3-dihydroisoindol-4-amine;dihydrochloride. InChIKey: GQIUIIYCIZEKJA-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2 |
|---|---|
| Molecular weight | 247.16 g/mol |
| IUPAC name | 2-cyclopropyl-1,3-dihydroisoindol-4-amine;dihydrochloride |
| InChIKey | GQIUIIYCIZEKJA-UHFFFAOYSA-N |
| SMILES | C1CC1N2CC3=C(C2)C(=CC=C3)N.Cl.Cl |
Computed by PubChem (NCBI)