CAS 1432681-49-6 is the registry number for 5-(Benzyloxy)-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-phenylmethoxy-3H-quinazolin-4-one (CAS 1432681-49-6) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 5-phenylmethoxy-3H-quinazolin-4-one. InChIKey: NJNGAQRVESDVCK-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 5-phenylmethoxy-3H-quinazolin-4-one |
| InChIKey | NJNGAQRVESDVCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC3=C2C(=O)NC=N3 |
Computed by PubChem (NCBI)