Products 143308-74-1
CAS 143308-74-1 appears in our catalog under these names: Methyl (3aR,7R,7aS)-7-acetoxy-2,2-dimethyl-3a,6,7,7a-tetrahydrobenzo[d][1,3]dioxole-5-carboxylate, 98%, 3,4-(Isopropylidenedioxy) Shikimic Acid Methyl Ester Acetate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g.
Methyl (3aR,7R,7aS)-7-acetyloxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (CAS 143308-74-1) is a chemical compound with the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. IUPAC name: methyl (3aR,7R,7aS)-7-acetyloxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate. InChIKey: QUCISDCTZZNDBF-MXWKQRLJSA-N.
| Molecular formula | C13H18O6 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | methyl (3aR,7R,7aS)-7-acetyloxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| InChIKey | QUCISDCTZZNDBF-MXWKQRLJSA-N |
| SMILES | CC(=O)O[C@@H]1CC(=C[C@@H]2[C@H]1OC(O2)(C)C)C(=O)OC |
Computed by PubChem (NCBI)