CAS 4304-12-5 appears in our catalog under these names: Benzyl beta-d-glucopyranoside, 95%, Benzyl beta-D-Glucopyranoside, >95% (HPLC), Benzyl β-D-Glucopyranoside, >95% (HPLC), Benzyl β-D-glucopyranoside, 95+%, Benzyl glucopyranoside. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 5g, 1mg, 10g, 2g, 1000mg.
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol (CAS 4304-12-5) is a chemical compound with the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol. InChIKey: GKHCBYYBLTXYEV-HENWMNBSSA-N.
| Molecular formula | C13H18O6 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
| InChIKey | GKHCBYYBLTXYEV-HENWMNBSSA-N |
| SMILES | C1=CC=C(C=C1)COC2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)