CAS 14897-46-2 appears in our catalog under these names: Benzyl b-D-galactopyranoside, 98%, Benzyl b-D-galactopyranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1g, 2g, 5g, 10g, 25g.
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol (CAS 14897-46-2) is a chemical compound with the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. IUPAC name: (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol. InChIKey: GKHCBYYBLTXYEV-KSSYENDESA-N.
| Molecular formula | C13H18O6 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
| InChIKey | GKHCBYYBLTXYEV-KSSYENDESA-N |
| SMILES | C1=CC=C(C=C1)CO[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)