CAS 3150-22-9 appears in our catalog under these names: 4-Methylphenyl beta-d-galactopyranoside, 95%, 4-Methylphenyl b-D-galactopyranoside. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 1000mg, 500mg, 2000mg, 5000mg.
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(4-methylphenoxy)oxane-3,4,5-triol (CAS 3150-22-9) is a chemical compound with the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. IUPAC name: (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(4-methylphenoxy)oxane-3,4,5-triol. InChIKey: MVLBSNPILSLTFZ-KSSYENDESA-N.
| Molecular formula | C13H18O6 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(4-methylphenoxy)oxane-3,4,5-triol |
| InChIKey | MVLBSNPILSLTFZ-KSSYENDESA-N |
| SMILES | CC1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)