CAS 1433204-06-8 appears in our catalog under these names: 5-Bromo-1(2H)-phthalazinone, 5-Bromophthalazin-1(2H)-one, 95%. Offered by: TRC, AmBeed. Available pack sizes: 1g.
5-bromo-2H-phthalazin-1-one (CAS 1433204-06-8) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromo-2H-phthalazin-1-one. InChIKey: CWAACMNYIMGXFD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromo-2H-phthalazin-1-one |
| InChIKey | CWAACMNYIMGXFD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NNC2=O)C(=C1)Br |
Computed by PubChem (NCBI)