CAS 143381-59-3 is the registry number for Agamanone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-5,7-dihydroxy-6-methoxy-2-(7-methoxy-1,3-benzodioxol-5-yl)-2,3-dihydrochromen-4-one (CAS 143381-59-3) is a chemical compound with the molecular formula C18H16O8 and a molecular weight of 360.3 g/mol. IUPAC name: (2S)-5,7-dihydroxy-6-methoxy-2-(7-methoxy-1,3-benzodioxol-5-yl)-2,3-dihydrochromen-4-one. InChIKey: OPMVFPLFBRWXER-NSHDSACASA-N.
| Molecular formula | C18H16O8 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | (2S)-5,7-dihydroxy-6-methoxy-2-(7-methoxy-1,3-benzodioxol-5-yl)-2,3-dihydrochromen-4-one |
| InChIKey | OPMVFPLFBRWXER-NSHDSACASA-N |
| SMILES | COC1=CC(=CC2=C1OCO2)[C@@H]3CC(=O)C4=C(O3)C=C(C(=C4O)OC)O |
Computed by PubChem (NCBI)