CAS 1433988-15-8 is the registry number for 3-Acetyl-6H-benzo(c)chromen-6-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
3-acetylbenzo[c]chromen-6-one (CAS 1433988-15-8) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 3-acetylbenzo[c]chromen-6-one. InChIKey: DUZHTHVSCRNOCI-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 3-acetylbenzo[c]chromen-6-one |
| InChIKey | DUZHTHVSCRNOCI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C3=CC=CC=C3C(=O)O2 |
Computed by PubChem (NCBI)