CAS 143468-11-5 is the registry number for (6-Chloro-1h-pyrrolo[2,3-b]pyridin-1-yl)(phenyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(6-chloropyrrolo[2,3-b]pyridin-1-yl)-phenylmethanone (CAS 143468-11-5) is a chemical compound with the molecular formula C14H9ClN2O and a molecular weight of 256.68 g/mol. IUPAC name: (6-chloropyrrolo[2,3-b]pyridin-1-yl)-phenylmethanone. InChIKey: UNOFAPHIMJQZQW-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | (6-chloropyrrolo[2,3-b]pyridin-1-yl)-phenylmethanone |
| InChIKey | UNOFAPHIMJQZQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N2C=CC3=C2N=C(C=C3)Cl |
Computed by PubChem (NCBI)