CAS 57644-24-3 is the registry number for 3-((4-chlorophenyl)imino)indolin-2-one. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
3-(4-chlorophenyl)imino-1H-indol-2-one (CAS 57644-24-3) is a chemical compound with the molecular formula C14H9ClN2O and a molecular weight of 256.68 g/mol. IUPAC name: 3-(4-chlorophenyl)imino-1H-indol-2-one. InChIKey: CPOOLXVTWFEFNO-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 3-(4-chlorophenyl)imino-1H-indol-2-one |
| InChIKey | CPOOLXVTWFEFNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC3=CC=C(C=C3)Cl)C(=O)N2 |
Computed by PubChem (NCBI)