CAS 286411-09-4 appears in our catalog under these names: 7–chloro–2–phenyl–1，8–naphthyridin–4–ol, 7-Chloro-2-phenyl-1,8-naphthyridin-4-ol, 97%, 7-Chloro-4-hydroxy-2-phenyl-1,8-naphthyridine, 95%, 95%, 7-chloro-2-phenyl-1,4-dihydro-1,8-naphthyridin-4-one, 95%. Offered by: GLPBio, AmBeed, Chemat, Fluorochem. Available pack sizes: 25mg, 5mg, 10mg.
7-chloro-2-phenyl-1H-1,8-naphthyridin-4-one (CAS 286411-09-4) is a chemical compound with the molecular formula C14H9ClN2O and a molecular weight of 256.68 g/mol. IUPAC name: 7-chloro-2-phenyl-1H-1,8-naphthyridin-4-one. InChIKey: JSCUNIPKMPNPFX-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 7-chloro-2-phenyl-1H-1,8-naphthyridin-4-one |
| InChIKey | JSCUNIPKMPNPFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(N2)N=C(C=C3)Cl |
Computed by PubChem (NCBI)