CAS 412339-45-8 appears in our catalog under these names: 2–(2–Chlorophenyl)phthalazin–1(2H)–one, 2-(2-CHLOROPHENYL)PHTHALAZIN-1(2H)-ONE, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 250mg.
2-(2-chlorophenyl)phthalazin-1-one (CAS 412339-45-8) is a chemical compound with the molecular formula C14H9ClN2O and a molecular weight of 256.68 g/mol. IUPAC name: 2-(2-chlorophenyl)phthalazin-1-one. InChIKey: MGCXIVPWSGEWGP-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 2-(2-chlorophenyl)phthalazin-1-one |
| InChIKey | MGCXIVPWSGEWGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN(C2=O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)