CAS 1435323-67-3 appears in our catalog under these names: Methyl 5-amino-2,4-dihydroxybenzoate, 97%, Methyl 5-amino-2,4-dihydroxybenzoate, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 500mg, 1g, 5g, 10g.
Methyl 5-amino-2,4-dihydroxybenzoate (CAS 1435323-67-3) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: methyl 5-amino-2,4-dihydroxybenzoate. InChIKey: OZKJEDPAZXWTSM-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | methyl 5-amino-2,4-dihydroxybenzoate |
| InChIKey | OZKJEDPAZXWTSM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)O)N |
Computed by PubChem (NCBI)