Products 143577-49-5

CAS 143577-49-5 is the registry number for Tetrahydro-​3H-​pyrrolo(1,​2-​c)​(1,​2,​3)​oxathiazole 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole 1,1-dioxide (CAS 143577-49-5) is a chemical compound with the molecular formula C5H9NO3S and a molecular weight of 163.20 g/mol. IUPAC name: 3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole 1,1-dioxide. InChIKey: WFFHPXGNIIMFHE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9NO3S
Molecular weight163.20 g/mol
IUPAC name3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c]oxathiazole 1,1-dioxide
InChIKeyWFFHPXGNIIMFHE-UHFFFAOYSA-N
SMILESC1CC2COS(=O)(=O)N2C1

Computed by PubChem (NCBI)