Products 1435805-24-5
CAS 1435805-24-5 is the registry number for tert-Butyl 6-amino-2,2-dimethyl-3-oxo-2H-pyrido[3,2-b][1,4]oxazine-4(3H)-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-amino-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazine-4-carboxylate (CAS 1435805-24-5) is a chemical compound with the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. IUPAC name: tert-butyl 6-amino-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazine-4-carboxylate. InChIKey: OMULLROHQRLBLD-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O4 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | tert-butyl 6-amino-2,2-dimethyl-3-oxopyrido[3,2-b][1,4]oxazine-4-carboxylate |
| InChIKey | OMULLROHQRLBLD-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C2=C(O1)C=CC(=N2)N)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)