CAS 67607-50-5 is the registry number for FA-Gly-Nva-NH2. Offered by: Creative Peptides, Biosynth. Available pack sizes: on request, 50mg, 25mg, 100mg, 250mg.
(2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]pentanamide (CAS 67607-50-5) is a chemical compound with the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. IUPAC name: (2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]pentanamide. InChIKey: UFGOYNARHNUQSD-MLRMMBSGSA-N.
| Molecular formula | C14H19N3O4 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | (2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]pentanamide |
| InChIKey | UFGOYNARHNUQSD-MLRMMBSGSA-N |
| SMILES | CCC[C@@H](C(=O)N)NC(=O)CNC(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)