Products 50444-54-7
CAS 50444-54-7 appears in our catalog under these names: Z-Ala-ala-nh2, 95%, Benzyl N-[(1S)-1-{[(1S)-1-carbamoylethyl]carbamoyl}ethyl]carbamate, 98%, Z-ALA-ALA-NH2. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 5g, 100mg, 500mg, 25g, 10g, 50g.
Benzyl N-[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate (CAS 50444-54-7) is a chemical compound with the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. IUPAC name: benzyl N-[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate. InChIKey: WEIOJLPDGBBVCH-UWVGGRQHSA-N.
| Molecular formula | C14H19N3O4 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | benzyl N-[(2S)-1-[[(2S)-1-amino-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| InChIKey | WEIOJLPDGBBVCH-UWVGGRQHSA-N |
| SMILES | C[C@@H](C(=O)N)NC(=O)[C@H](C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)