CAS 67607-49-2 is the registry number for FA-Gly-Val-NH2. Offered by: Creative Peptides, Biosynth. Available pack sizes: on request, 250mg, 100mg, 500mg.
(2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanamide (CAS 67607-49-2) is a chemical compound with the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. IUPAC name: (2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanamide. InChIKey: WKUJNPGXTNWFHD-GFUIURDCSA-N.
| Molecular formula | C14H19N3O4 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | (2S)-2-[[2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanamide |
| InChIKey | WKUJNPGXTNWFHD-GFUIURDCSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)CNC(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)