Products 1435806-20-4

CAS 1435806-20-4 is the registry number for 2-Methyl-5-(trifluoromethoxy)-dl-phenylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-3-[2-methyl-5-(trifluoromethoxy)phenyl]propanoic acid (CAS 1435806-20-4) is a chemical compound with the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. IUPAC name: 2-amino-3-[2-methyl-5-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: SVEYQDBJEVXPQH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12F3NO3
Molecular weight263.21 g/mol
IUPAC name2-amino-3-[2-methyl-5-(trifluoromethoxy)phenyl]propanoic acid
InChIKeySVEYQDBJEVXPQH-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)OC(F)(F)F)CC(C(=O)O)N

Computed by PubChem (NCBI)