Products 1706428-65-0
CAS 1706428-65-0 appears in our catalog under these names: 2-Methyl-4-(trifluoromethoxy)-dl-phenylalanine, 95%, 2-Amino-3-(2-methyl-4-(trifluoromethoxy)phenyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-amino-3-[2-methyl-4-(trifluoromethoxy)phenyl]propanoic acid (CAS 1706428-65-0) is a chemical compound with the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. IUPAC name: 2-amino-3-[2-methyl-4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: POJFIIFTOPDUEM-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO3 |
|---|---|
| Molecular weight | 263.21 g/mol |
| IUPAC name | 2-amino-3-[2-methyl-4-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | POJFIIFTOPDUEM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC(F)(F)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)