Products 958297-39-7
CAS 958297-39-7 appears in our catalog under these names: 3-phenylazetidin-3-ol trifluoroacetic acid, 95%, 3-Phenylazetidin-3-ol, trifluoroacetic acid, 95%, 3-Phenylazetidin-3-ol, trifluoroacetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 100mg, 1g, 10g, 2,5g.
3-phenylazetidin-3-ol;2,2,2-trifluoroacetic acid (CAS 958297-39-7) is a chemical compound with the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. IUPAC name: 3-phenylazetidin-3-ol;2,2,2-trifluoroacetic acid. InChIKey: RIYUWUOCUQVEPN-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO3 |
|---|---|
| Molecular weight | 263.21 g/mol |
| IUPAC name | 3-phenylazetidin-3-ol;2,2,2-trifluoroacetic acid |
| InChIKey | RIYUWUOCUQVEPN-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC=CC=C2)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)
Synonyms:
3-phenylazetidin-3-ol; trifluoroacetic acid, 3-phenylazetidin-3-ol, trifluoroacetic acid, 3-phenylazetidin-3-ol;2,2,2-trifluoroacetic acid, 3-phenylazetidin-3-ol trifluoroacetic acid, 3-phenylazetidin-3-ol,trifluoroaceticacid, 3-Hydroxy-3-phenylazetidine trifluoroacetate, 3-Phenylazetidin-3-ol trifluoroacetic acid