CAS 2270913-81-8 is the registry number for 4-Hydroxy-n,n-dimethyl-3-(2,2,2-trifluoro-ethoxy)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-hydroxy-N,N-dimethyl-3-(2,2,2-trifluoroethoxy)benzamide (CAS 2270913-81-8) is a chemical compound with the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. IUPAC name: 4-hydroxy-N,N-dimethyl-3-(2,2,2-trifluoroethoxy)benzamide. InChIKey: ZIIVEWIHHJIKRN-UHFFFAOYSA-N.
| Molecular formula | C11H12F3NO3 |
|---|---|
| Molecular weight | 263.21 g/mol |
| IUPAC name | 4-hydroxy-N,N-dimethyl-3-(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | ZIIVEWIHHJIKRN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)O)OCC(F)(F)F |
Computed by PubChem (NCBI)