Products 1435933-91-7

CAS 1435933-91-7 is the registry number for 6-Aminocyclohex-3-enecarboxylic acid hydrochloride 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

6-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride (CAS 1435933-91-7) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: 6-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride. InChIKey: HZJHDHWPTTVQSN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClNO2
Molecular weight177.63 g/mol
IUPAC name6-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride
InChIKeyHZJHDHWPTTVQSN-UHFFFAOYSA-N
SMILESC1C=CCC(C1C(=O)O)N.Cl

Computed by PubChem (NCBI)