CAS 57266-56-5 appears in our catalog under these names: cis-6-Aminocyclo-hex-3-ene-COOH*HCl, cis-6-Amino-cyclohex-3-enecarboxylic acid hydrochloride, cis-6-Amino-3-cyclohexene-1-carboxylic acid hydrochloride 97%, cis-6-Aminocyclohex-3-enecarboxylic acid hydrochloride, 97%, 97%, (1R,6S)-6-Aminocyclohex-3-enecarboxylic acid hydrochloride, 97%,RG. Offered by: Iris Biotech, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 2,5g, 250mg, 100mg.
(1R,6S)-6-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride (CAS 57266-56-5) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: (1R,6S)-6-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride. InChIKey: HZJHDHWPTTVQSN-IBTYICNHSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | (1R,6S)-6-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride |
| InChIKey | HZJHDHWPTTVQSN-IBTYICNHSA-N |
| SMILES | C1C=CC[C@@H]([C@@H]1C(=O)O)N.Cl |
Computed by PubChem (NCBI)