CAS 1437051-80-3 is the registry number for 6-(Aminomethyl)-3,3-dimethylbenzo(c)(1,2)oxaborol-1(3H)-ol, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methanamine (CAS 1437051-80-3) is a chemical compound with the molecular formula C10H14BNO2 and a molecular weight of 191.04 g/mol. IUPAC name: (1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methanamine. InChIKey: GOKXCNGZACOZPV-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO2 |
|---|---|
| Molecular weight | 191.04 g/mol |
| IUPAC name | (1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)methanamine |
| InChIKey | GOKXCNGZACOZPV-UHFFFAOYSA-N |
| SMILES | B1(C2=C(C=CC(=C2)CN)C(O1)(C)C)O |
Computed by PubChem (NCBI)