CAS 2225171-69-5 is the registry number for (6–cyclopentylpyridin–3–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
(6-cyclopentyl-3-pyridinyl)boronic acid (CAS 2225171-69-5) is a chemical compound with the molecular formula C10H14BNO2 and a molecular weight of 191.04 g/mol. IUPAC name: (6-cyclopentyl-3-pyridinyl)boronic acid. InChIKey: TWOQSCHZCVIRRW-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO2 |
|---|---|
| Molecular weight | 191.04 g/mol |
| IUPAC name | (6-cyclopentyl-3-pyridinyl)boronic acid |
| InChIKey | TWOQSCHZCVIRRW-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C2CCCC2)(O)O |
Computed by PubChem (NCBI)