Products 1437385-42-6
CAS 1437385-42-6 is the registry number for 4-Chloro-2-cyclopentylpyrido(3,4-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg, 2000mg.
4-chloro-2-cyclopentylpyrido[3,4-d]pyrimidine (CAS 1437385-42-6) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 4-chloro-2-cyclopentylpyrido[3,4-d]pyrimidine. InChIKey: NXXXAEHQHYGIIU-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 4-chloro-2-cyclopentylpyrido[3,4-d]pyrimidine |
| InChIKey | NXXXAEHQHYGIIU-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC3=C(C=CN=C3)C(=N2)Cl |
Computed by PubChem (NCBI)