CAS 14377-63-0 appears in our catalog under these names: 2-Oxo-1-phenyl-2-piperidin-1-ylethanone, 98%, 1-Phenyl-2-(piperidin-1-yl)ethane-1,2-dione, 95-<97%, 1-Phenyl-2-(piperidin-1-yl)ethane-1,2-dione, ≥97-<99%, 1-Phenyl-2-(piperidin-1-yl)ethane-1,2-dione, 95+%, 1–Phenyl–2–(piperidin–1–yl)ethane–1,2–dione. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 50g, 100g, 100mg.
1-phenyl-2-piperidin-1-ylethane-1,2-dione (CAS 14377-63-0) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 1-phenyl-2-piperidin-1-ylethane-1,2-dione. InChIKey: BWSCMJUJHSJAEV-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 1-phenyl-2-piperidin-1-ylethane-1,2-dione |
| InChIKey | BWSCMJUJHSJAEV-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)