CAS 1437794-71-2 is the registry number for 5-Ethoxy-N-methyl-2-nitroaniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
5-ethoxy-N-methyl-2-nitroaniline (CAS 1437794-71-2) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 5-ethoxy-N-methyl-2-nitroaniline. InChIKey: UGVXPEJCGCNAKW-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 5-ethoxy-N-methyl-2-nitroaniline |
| InChIKey | UGVXPEJCGCNAKW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)[N+](=O)[O-])NC |
Computed by PubChem (NCBI)