CAS 1437794-81-4 is the registry number for 2-Fluoro-3-(trifluoromethoxy)phenyl acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2-fluoro-3-(trifluoromethoxy)phenyl] acetate (CAS 1437794-81-4) is a chemical compound with the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. IUPAC name: [2-fluoro-3-(trifluoromethoxy)phenyl] acetate. InChIKey: VONKDBFQWGSSQG-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O3 |
|---|---|
| Molecular weight | 238.14 g/mol |
| IUPAC name | [2-fluoro-3-(trifluoromethoxy)phenyl] acetate |
| InChIKey | VONKDBFQWGSSQG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C(=CC=C1)OC(F)(F)F)F |
Computed by PubChem (NCBI)