Products 1437795-17-9
CAS 1437795-17-9 appears in our catalog under these names: 7-Bromo-1-ethyl-1,3-benzodiazole-5-carboxylic acid, 97%, 7-Bromo-1-ethyl-1,3-benzodiazole-5-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
7-bromo-1-ethylbenzimidazole-5-carboxylic acid (CAS 1437795-17-9) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 7-bromo-1-ethylbenzimidazole-5-carboxylic acid. InChIKey: YYDGDSIIYVSFSG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 7-bromo-1-ethylbenzimidazole-5-carboxylic acid |
| InChIKey | YYDGDSIIYVSFSG-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1C(=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)