CAS 143825-96-1 is the registry number for (E)-2-(Buta-1,3-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% +(stabilized with TBC). Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2-[(1E)-buta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 143825-96-1) is a chemical compound with the molecular formula C10H17BO2 and a molecular weight of 180.05 g/mol. IUPAC name: 2-[(1E)-buta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HUUYPRUYJXORBI-BQYQJAHWSA-N.
| Molecular formula | C10H17BO2 |
|---|---|
| Molecular weight | 180.05 g/mol |
| IUPAC name | 2-[(1E)-buta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HUUYPRUYJXORBI-BQYQJAHWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C=C |
Computed by PubChem (NCBI)