CAS 72049-19-5 appears in our catalog under these names: Emodin Impurity 12, 1,3-Diacetyl Aloe-emodin. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-cyclobut-2-en-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 72049-19-5) is a chemical compound with the molecular formula C10H17BO2 and a molecular weight of 180.05 g/mol. IUPAC name: 2-cyclobut-2-en-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YUISCWSUVATNMU-UHFFFAOYSA-N.
| Molecular formula | C10H17BO2 |
|---|---|
| Molecular weight | 180.05 g/mol |
| IUPAC name | 2-cyclobut-2-en-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YUISCWSUVATNMU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CC=C2 |
Computed by PubChem (NCBI)