CAS 2758648-30-3 is the registry number for 2-(Cyclobut-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
2-(cyclobuten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2758648-30-3) is a chemical compound with the molecular formula C10H17BO2 and a molecular weight of 180.05 g/mol. IUPAC name: 2-(cyclobuten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LLTZEZDNMMMYFJ-UHFFFAOYSA-N.
| Molecular formula | C10H17BO2 |
|---|---|
| Molecular weight | 180.05 g/mol |
| IUPAC name | 2-(cyclobuten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LLTZEZDNMMMYFJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC2 |
Computed by PubChem (NCBI)