Products 871333-99-2
CAS 871333-99-2 is the registry number for (1S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-en-2-ylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
[(1S)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]boronic acid (CAS 871333-99-2) is a chemical compound with the molecular formula C10H17BO2 and a molecular weight of 180.05 g/mol. IUPAC name: [(1S)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]boronic acid. InChIKey: ZGDNWNBGFZOLLT-MHPPCMCBSA-N.
| Molecular formula | C10H17BO2 |
|---|---|
| Molecular weight | 180.05 g/mol |
| IUPAC name | [(1S)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]boronic acid |
| InChIKey | ZGDNWNBGFZOLLT-MHPPCMCBSA-N |
| SMILES | B(C1=CC2CC[C@@]1(C2(C)C)C)(O)O |
Computed by PubChem (NCBI)