Products 1438721-51-7
CAS 1438721-51-7 is the registry number for Longanlactone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S,5R)-3-(2-acetylpyrrol-1-yl)-5-prop-2-ynyloxolan-2-one (CAS 1438721-51-7) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: (3S,5R)-3-(2-acetylpyrrol-1-yl)-5-prop-2-ynyloxolan-2-one. InChIKey: QTKQNYHMCDFYCF-PWSUYJOCSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (3S,5R)-3-(2-acetylpyrrol-1-yl)-5-prop-2-ynyloxolan-2-one |
| InChIKey | QTKQNYHMCDFYCF-PWSUYJOCSA-N |
| SMILES | CC(=O)C1=CC=CN1[C@H]2C[C@H](OC2=O)CC#C |
Computed by PubChem (NCBI)