Products 14389-99-2
CAS 14389-99-2 is the registry number for Methyl 2-cyano(2,2-dimethyltetrahydro-4h-pyran-4-ylidene)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2Z)-2-cyano-2-(2,2-dimethyloxan-4-ylidene)acetate (CAS 14389-99-2) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: methyl (2Z)-2-cyano-2-(2,2-dimethyloxan-4-ylidene)acetate. InChIKey: YGFDEICDZALXGL-HJWRWDBZSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | methyl (2Z)-2-cyano-2-(2,2-dimethyloxan-4-ylidene)acetate |
| InChIKey | YGFDEICDZALXGL-HJWRWDBZSA-N |
| SMILES | CC1(C/C(=C(/C#N)\C(=O)OC)/CCO1)C |
Computed by PubChem (NCBI)