Products 1439366-66-1
CAS 1439366-66-1 is the registry number for NAAA-IN-1, 99.65%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg.
(4-phenylphenyl)methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate (CAS 1439366-66-1) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: (4-phenylphenyl)methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate. InChIKey: MFQATLPMLVIJGV-BLLLJJGKSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (4-phenylphenyl)methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
| InChIKey | MFQATLPMLVIJGV-BLLLJJGKSA-N |
| SMILES | C[C@H]1[C@H](C(=O)O1)NC(=O)OCC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)