CAS 143946-49-0 appears in our catalog under these names: 4-Chloro-5,7-dimethoxyquinoline, 95%, 4–Chloro–5,7–dimethoxyquinoline, 4-Chloro-5,7-dimethoxyquinoline, 4-Chloro-5,7-dimethoxyquinoline 97%, 4-Chloro-5,7-dimethoxyquinoline, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-chloro-5,7-dimethoxyquinoline (CAS 143946-49-0) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 4-chloro-5,7-dimethoxyquinoline. InChIKey: JSOONZDJCBQKRD-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 4-chloro-5,7-dimethoxyquinoline |
| InChIKey | JSOONZDJCBQKRD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C(=C1)OC)Cl |
Computed by PubChem (NCBI)