Products 1439902-45-0
CAS 1439902-45-0 is the registry number for 1-(Cyclobutylmethyl)-2-oxo-1,2-dihydropyrimidine-5-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-(cyclobutylmethyl)-2-oxopyrimidine-5-carboxylic acid (CAS 1439902-45-0) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 1-(cyclobutylmethyl)-2-oxopyrimidine-5-carboxylic acid. InChIKey: TXOSZPHUQZAVEQ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 1-(cyclobutylmethyl)-2-oxopyrimidine-5-carboxylic acid |
| InChIKey | TXOSZPHUQZAVEQ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)CN2C=C(C=NC2=O)C(=O)O |
Computed by PubChem (NCBI)