CAS 144054-74-0 appears in our catalog under these names: (S)–Ethyl 2–amino–3,3–dimethylbutanoate hydrochloride, (S)-Ethyl 2-amino-3,3-dimethylbutanoate hydrochloride, (S)-Ethyl 2-Amino-3,3-Dimethylbutanoate Hydrochloride, 98%, 98%, (S)-ethyl 2-amino-3,3-dimethylbutanoate hydrochloride, 98%, H-tert-Leu-OEt·HCl, 99%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 25mg, 0,25g, 250mg, 1g, 5g.
Ethyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride (CAS 144054-74-0) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: ethyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride. InChIKey: JSLXQBBNYLYHHV-FYZOBXCZSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | ethyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride |
| InChIKey | JSLXQBBNYLYHHV-FYZOBXCZSA-N |
| SMILES | CCOC(=O)[C@H](C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)