CAS 144072-30-0 appears in our catalog under these names: tert-butyl 4-formylphenylcarbamate, 97%, 97%, tert-Butyl 4-formylphenylcarbamate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 250g, 500g.
Tert-butyl N-(4-formylphenyl)carbamate (CAS 144072-30-0) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: tert-butyl N-(4-formylphenyl)carbamate. InChIKey: SVQVBAUJEKSBEC-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | tert-butyl N-(4-formylphenyl)carbamate |
| InChIKey | SVQVBAUJEKSBEC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)