Products 1441-58-3

CAS 1441-58-3 is the registry number for octa-2,4,6-trienedioic acid diethyl ester. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl (2E,4E,6E)-octa-2,4,6-trienedioate (CAS 1441-58-3) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: diethyl (2E,4E,6E)-octa-2,4,6-trienedioate. InChIKey: LDZFMEPAWXQNAM-NRIIQWGUSA-N.

Identity
Molecular formulaC12H16O4
Molecular weight224.25 g/mol
IUPAC namediethyl (2E,4E,6E)-octa-2,4,6-trienedioate
InChIKeyLDZFMEPAWXQNAM-NRIIQWGUSA-N
SMILESCCOC(=O)/C=C/C=C/C=C/C(=O)OCC

Computed by PubChem (NCBI)