CAS 1443358-06-2 is the registry number for 3-Chloro-2-nitro p-Anisidine. Offered by: TRC. Available pack sizes: 500mg.
3-chloro-N-(4-methoxyphenyl)-2-nitroaniline (CAS 1443358-06-2) is a chemical compound with the molecular formula C13H11ClN2O3 and a molecular weight of 278.69 g/mol. IUPAC name: 3-chloro-N-(4-methoxyphenyl)-2-nitroaniline. InChIKey: KPXMOHMQCLQOJZ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O3 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | 3-chloro-N-(4-methoxyphenyl)-2-nitroaniline |
| InChIKey | KPXMOHMQCLQOJZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=C(C(=CC=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)