CAS 1443412-41-6 is the registry number for 2-(3,5-Dichlorophenyl)malonic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-(3,5-dichlorophenyl)propanedioic acid (CAS 1443412-41-6) is a chemical compound with the molecular formula C9H6Cl2O4 and a molecular weight of 249.04 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)propanedioic acid. InChIKey: YJNQGHZDKPTGLL-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O4 |
|---|---|
| Molecular weight | 249.04 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)propanedioic acid |
| InChIKey | YJNQGHZDKPTGLL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)